C16H25BFNO3 — CID 59558599
2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-N,N-dimethylethanamine (PubChem CID 59558599) has the molecular formula C16H25BFNO3 and a molecular weight of 309.19 g/mol. Its IUPAC name is 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59558599 |
| Molecular Formula | C16H25BFNO3 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cc(B2OC(C)(C)C(C)(C)O2)ccc1F |
| InChI | InChI=1S/C16H25BFNO3/c1-15(2)16(3,4)22-17(21-15)12-7-8-13(18)14(11-12)20-10-9-19(5)6/h7-8,11H,9-10H2,1-6H3 |
| InChIKey | NIOWRFXJJHSKAC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|