C17H28BNO4 — CID 161056043
2-[methyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]amino]ethanol (PubChem CID 161056043) has the molecular formula C17H28BNO4 and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-[methyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]amino]ethanol.
| Compound Name | 2-[methyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 161056043 |
| Molecular Formula | C17H28BNO4 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-[methyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]amino]ethanol |
| SMILES | CN(CCO)CCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H28BNO4/c1-16(2)17(3,4)23-18(22-16)14-6-8-15(9-7-14)21-13-11-19(5)10-12-20/h6-9,20H,10-13H2,1-5H3 |
| InChIKey | JSHBHAISYUJGHN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|