C19H27BN2O3 — CID 123996425
N,N-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]oxyethanamine (PubChem CID 123996425) has the molecular formula C19H27BN2O3 and a molecular weight of 342.25 g/mol. Its IUPAC name is N,N-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]oxyethanamine |
|---|---|
| PubChem CID | 123996425 |
| Molecular Formula | C19H27BN2O3 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N,N-dimethyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-8-yl]oxyethanamine |
| SMILES | CN(C)CCOc1ccc(B2OC(C)(C)C(C)(C)O2)c2cccnc12 |
| InChI | InChI=1S/C19H27BN2O3/c1-18(2)19(3,4)25-20(24-18)15-9-10-16(23-13-12-22(5)6)17-14(15)8-7-11-21-17/h7-11H,12-13H2,1-6H3 |
| InChIKey | KLMXXKVREZAMIX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|