C16H20BNO3S — CID 174077936
2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1,3-thiazole (PubChem CID 174077936) has the molecular formula C16H20BNO3S and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1,3-thiazole.
| Compound Name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1,3-thiazole |
|---|---|
| PubChem CID | 174077936 |
| Molecular Formula | C16H20BNO3S |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1,3-thiazole |
| SMILES | Cc1nc(Oc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cs1 |
| InChI | InChI=1S/C16H20BNO3S/c1-11-18-14(10-22-11)19-13-8-6-12(7-9-13)17-20-15(2,3)16(4,5)21-17/h6-10H,1-5H3 |
| InChIKey | CRMVKHSCARWQLN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|