C14H22BO5P — CID 91024235
2-[4-[methoxy(methyl)phosphoryl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 91024235) has the molecular formula C14H22BO5P and a molecular weight of 312.11 g/mol. Its IUPAC name is 2-[4-[methoxy(methyl)phosphoryl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[methoxy(methyl)phosphoryl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 91024235 |
| Molecular Formula | C14H22BO5P |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[4-[methoxy(methyl)phosphoryl]oxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COP(C)(=O)Oc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C14H22BO5P/c1-13(2)14(3,4)20-15(19-13)11-7-9-12(10-8-11)18-21(6,16)17-5/h7-10H,1-6H3 |
| InChIKey | BOSLMGINTNVIOK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|