C20H35BO3Si — CID 167730544
tert-butyl-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane (PubChem CID 167730544) has the molecular formula C20H35BO3Si and a molecular weight of 362.40 g/mol. Its IUPAC name is tert-butyl-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 167730544 |
| Molecular Formula | C20H35BO3Si |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | tert-butyl-[2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35BO3Si/c1-11-15-14-16(21-23-19(5,6)20(7,8)24-21)12-13-17(15)22-25(9,10)18(2,3)4/h12-14H,11H2,1-10H3 |
| InChIKey | LONDMFNDPKOIJU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|