C16H25BO4Si — CID 167729950
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilyloxybenzaldehyde (PubChem CID 167729950) has the molecular formula C16H25BO4Si and a molecular weight of 320.27 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilyloxybenzaldehyde.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilyloxybenzaldehyde |
|---|---|
| PubChem CID | 167729950 |
| Molecular Formula | C16H25BO4Si |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-trimethylsilyloxybenzaldehyde |
| SMILES | CC1(C)OB(c2ccc(O[Si](C)(C)C)c(C=O)c2)OC1(C)C |
| InChI | InChI=1S/C16H25BO4Si/c1-15(2)16(3,4)21-17(20-15)13-8-9-14(12(10-13)11-18)19-22(5,6)7/h8-11H,1-7H3 |
| InChIKey | KHJTYEKBIIWRIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|