C13H18BNO4 — CID 169115117
2-(hydroxyamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (PubChem CID 169115117) has the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. Its IUPAC name is 2-(hydroxyamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde.
| Compound Name | 2-(hydroxyamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 169115117 |
| Molecular Formula | C13H18BNO4 |
| Molecular Weight | 263.10 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(hydroxyamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| SMILES | CC1(C)OB(c2ccc(C=O)c(NO)c2)OC1(C)C |
| InChI | InChI=1S/C13H18BNO4/c1-12(2)13(3,4)19-14(18-12)10-6-5-9(8-16)11(7-10)15-17/h5-8,15,17H,1-4H3 |
| InChIKey | UESRWCPIJJZRLJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|