C14H19BN2O3S — CID 169359319
[2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thiourea (PubChem CID 169359319) has the molecular formula C14H19BN2O3S and a molecular weight of 306.20 g/mol. Its IUPAC name is [2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thiourea.
| Compound Name | [2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169359319 |
| Molecular Formula | C14H19BN2O3S |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]thiourea |
| SMILES | CC1(C)OB(c2ccc(NC(N)=S)c(C=O)c2)OC1(C)C |
| InChI | InChI=1S/C14H19BN2O3S/c1-13(2)14(3,4)20-15(19-13)10-5-6-11(17-12(16)21)9(7-10)8-18/h5-8H,1-4H3,(H3,16,17,21) |
| InChIKey | FEURAQGLXBDJDW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|