C20H22BN3O5 — CID 168549504
methyl 3-amino-4-cyano-1-[2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate (PubChem CID 168549504) has the molecular formula C20H22BN3O5 and a molecular weight of 395.22 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168549504 |
| Molecular Formula | C20H22BN3O5 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C=O |
| InChI | InChI=1S/C20H22BN3O5/c1-19(2)20(3,4)29-21(28-19)14-6-7-15(12(8-14)11-25)24-10-13(9-22)16(23)17(24)18(26)27-5/h6-8,10-11H,23H2,1-5H3 |
| InChIKey | OPOGKHIRQCYKRU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|