C21H23BO5 — CID 88948955
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]benzene-1,3-dicarbaldehyde (PubChem CID 88948955) has the molecular formula C21H23BO5 and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]benzene-1,3-dicarbaldehyde.
| Compound Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 88948955 |
| Molecular Formula | C21H23BO5 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]benzene-1,3-dicarbaldehyde |
| SMILES | CC1(C)OB(c2ccc(COc3ccc(C=O)cc3C=O)cc2)OC1(C)C |
| InChI | InChI=1S/C21H23BO5/c1-20(2)21(3,4)27-22(26-20)18-8-5-15(6-9-18)14-25-19-10-7-16(12-23)11-17(19)13-24/h5-13H,14H2,1-4H3 |
| InChIKey | LYVKWOMGMLXRFY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|