C22H39BO3Si — CID 135742476
tert-butyl-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane (PubChem CID 135742476) has the molecular formula C22H39BO3Si and a molecular weight of 390.45 g/mol. Its IUPAC name is tert-butyl-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135742476 |
| Molecular Formula | C22H39BO3Si |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | tert-butyl-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)c1cc(O[Si](C)(C)C(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H39BO3Si/c1-19(2,3)16-13-17(23-25-21(7,8)22(9,10)26-23)15-18(14-16)24-27(11,12)20(4,5)6/h13-15H,1-12H3 |
| InChIKey | MEJKLEBIBVMILV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|