C22H29BO2 — CID 170671848
2-[3-tert-butyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 170671848) has the molecular formula C22H29BO2 and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-tert-butyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170671848 |
| Molecular Formula | C22H29BO2 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 2-[3-tert-butyl-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(B3OC(C)(C)C(C)(C)O3)cc(C(C)(C)C)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C22H29BO2/c1-20(2,3)18-13-17(16-11-9-8-10-12-16)14-19(15-18)23-24-21(4,5)22(6,7)25-23/h8-15H,1-7H3/i8D,9D,10D,11D,12D |
| InChIKey | RGETUVUQXSNBNM-AERUFEGBSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|