C37H31BO4 — CID 176758668
3-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]xanthen-9-one (PubChem CID 176758668) has the molecular formula C37H31BO4 and a molecular weight of 555.49 g/mol. Its IUPAC name is 3-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]xanthen-9-one.
| Compound Name | 3-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 176758668 |
| Molecular Formula | C37H31BO4 |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 3-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]xanthen-9-one |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3ccc(-c4ccc5c(=O)c6ccccc6oc5c4)cc3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C37H31BO4/c1-36(2)37(3,4)42-38(41-36)30-21-28(24-10-6-5-7-11-24)20-29(22-30)26-16-14-25(15-17-26)27-18-19-32-34(23-27)40-33-13-9-8-12-31(33)35(32)39/h5-23H,1-4H3/i5D,6D,7D,10D,11D |
| InChIKey | SEFCXKHEEFGPAV-HCNOYMLYSA-N |
| XLogP | 8.25 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|