C19H31BO3 — CID 70913706
2-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol (PubChem CID 70913706) has the molecular formula C19H31BO3 and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol.
| Compound Name | 2-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70913706 |
| Molecular Formula | C19H31BO3 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 2-[3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C19H31BO3/c1-16(2,3)13-10-14(17(4,5)21)12-15(11-13)20-22-18(6,7)19(8,9)23-20/h10-12,21H,1-9H3 |
| InChIKey | PLAQDHCHNRGHNE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|