C18H29BO2 — CID 149413877
2-(5-tert-butyl-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 149413877) has the molecular formula C18H29BO2 and a molecular weight of 288.24 g/mol. Its IUPAC name is 2-(5-tert-butyl-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(5-tert-butyl-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 149413877 |
| Molecular Formula | C18H29BO2 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-(5-tert-butyl-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(C(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1C |
| InChI | InChI=1S/C18H29BO2/c1-12-10-14(16(3,4)5)11-15(13(12)2)19-20-17(6,7)18(8,9)21-19/h10-11H,1-9H3 |
| InChIKey | YRUIVVCESVFJHK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|