C26H37BO5 — CID 153294759
2-[4-[4-(2-hydroxypropan-2-yl)-2,6-dimethylphenoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol (PubChem CID 153294759) has the molecular formula C26H37BO5 and a molecular weight of 440.39 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxypropan-2-yl)-2,6-dimethylphenoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol.
| Compound Name | 2-[4-[4-(2-hydroxypropan-2-yl)-2,6-dimethylphenoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153294759 |
| Molecular Formula | C26H37BO5 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-[4-[4-(2-hydroxypropan-2-yl)-2,6-dimethylphenoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol |
| SMILES | Cc1cc(C(C)(C)O)cc(C)c1Oc1ccc(C(C)(C)O)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H37BO5/c1-16-13-19(24(5,6)29)14-17(2)22(16)30-21-12-11-18(23(3,4)28)15-20(21)27-31-25(7,8)26(9,10)32-27/h11-15,28-29H,1-10H3 |
| InChIKey | GPWSEMFHMSKFOC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|