C16H25BO3 — CID 159584434
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trideuteriomethyl)phenyl]propan-2-ol (PubChem CID 159584434) has the molecular formula C16H25BO3 and a molecular weight of 279.20 g/mol. Its IUPAC name is 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trideuteriomethyl)phenyl]propan-2-ol.
| Compound Name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trideuteriomethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 159584434 |
| Molecular Formula | C16H25BO3 |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trideuteriomethyl)phenyl]propan-2-ol |
| SMILES | [2H]C([2H])([2H])c1ccc(C(C)(C)O)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H25BO3/c1-11-8-9-12(14(2,3)18)10-13(11)17-19-15(4,5)16(6,7)20-17/h8-10,18H,1-7H3/i1D3 |
| InChIKey | MJKWTZQFRNRPFJ-FIBGUPNXSA-N |
| XLogP | 2.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|