C16H23BF2O3 — CID 70655093
1-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methylpropan-2-ol (PubChem CID 70655093) has the molecular formula C16H23BF2O3 and a molecular weight of 312.17 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methylpropan-2-ol.
| Compound Name | 1-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 70655093 |
| Molecular Formula | C16H23BF2O3 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)Cc1cc(F)c(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C16H23BF2O3/c1-14(2,20)9-10-7-11(18)13(12(19)8-10)17-21-15(3,4)16(5,6)22-17/h7-8,20H,9H2,1-6H3 |
| InChIKey | YGLBQMKAIMRMIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|