C22H34B2F2O4 — CID 172522397
2-[2-tert-butyl-4,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 172522397) has the molecular formula C22H34B2F2O4 and a molecular weight of 422.13 g/mol. Its IUPAC name is 2-[2-tert-butyl-4,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-tert-butyl-4,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172522397 |
| Molecular Formula | C22H34B2F2O4 |
| Molecular Weight | 422.13 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-[2-tert-butyl-4,6-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)c1c(B2OC(C)(C)C(C)(C)O2)c(F)cc(F)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34B2F2O4/c1-18(2,3)15-16(23-27-19(4,5)20(6,7)28-23)13(25)12-14(26)17(15)24-29-21(8,9)22(10,11)30-24/h12H,1-11H3 |
| InChIKey | NQLIOVCEASAIGI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.13 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|