C15H21BF2O3 — CID 90043190
2-[4-(ethoxymethyl)-2,6-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90043190) has the molecular formula C15H21BF2O3 and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-[4-(ethoxymethyl)-2,6-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(ethoxymethyl)-2,6-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90043190 |
| Molecular Formula | C15H21BF2O3 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[4-(ethoxymethyl)-2,6-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCOCc1cc(F)c(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C15H21BF2O3/c1-6-19-9-10-7-11(17)13(12(18)8-10)16-20-14(2,3)15(4,5)21-16/h7-8H,6,9H2,1-5H3 |
| InChIKey | RXTSCIAFTSQDFJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|