C14H21BF2O3 — CID 143678827
3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;ethane (PubChem CID 143678827) has the molecular formula C14H21BF2O3 and a molecular weight of 286.13 g/mol. Its IUPAC name is 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;ethane.
| Compound Name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;ethane |
|---|---|
| PubChem CID | 143678827 |
| Molecular Formula | C14H21BF2O3 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;ethane |
| SMILES | CC.CC1(C)OB(c2c(F)cc(O)cc2F)OC1(C)C |
| InChI | InChI=1S/C12H15BF2O3.C2H6/c1-11(2)12(3,4)18-13(17-11)10-8(14)5-7(16)6-9(10)15;1-2/h5-6,16H,1-4H3;1-2H3 |
| InChIKey | PADJYHYPUJGNDQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|