C17H23BF2O4 — CID 70654776
4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-4-ol (PubChem CID 70654776) has the molecular formula C17H23BF2O4 and a molecular weight of 340.18 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-4-ol.
| Compound Name | 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-4-ol |
|---|---|
| PubChem CID | 70654776 |
| Molecular Formula | C17H23BF2O4 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-4-ol |
| SMILES | CC1(C)OB(c2c(F)cc(C3(O)CCOCC3)cc2F)OC1(C)C |
| InChI | InChI=1S/C17H23BF2O4/c1-15(2)16(3,4)24-18(23-15)14-12(19)9-11(10-13(14)20)17(21)5-7-22-8-6-17/h9-10,21H,5-8H2,1-4H3 |
| InChIKey | MVOQYESDZCXDQL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|