C17H23BF2O4 — CID 70655284
2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70655284) has the molecular formula C17H23BF2O4 and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70655284 |
| Molecular Formula | C17H23BF2O4 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2c(F)cc(OC3CCOCC3)cc2F)OC1(C)C |
| InChI | InChI=1S/C17H23BF2O4/c1-16(2)17(3,4)24-18(23-16)15-13(19)9-12(10-14(15)20)22-11-5-7-21-8-6-11/h9-11H,5-8H2,1-4H3 |
| InChIKey | BYBYUFRAGSEEBM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|