C18H26BF3O2 — CID 169250167
2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169250167) has the molecular formula C18H26BF3O2 and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169250167 |
| Molecular Formula | C18H26BF3O2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[2,5-dimethyl-4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(C(C)(C)C(F)(F)F)c(C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BF3O2/c1-11-10-14(19-23-16(5,6)17(7,8)24-19)12(2)9-13(11)15(3,4)18(20,21)22/h9-10H,1-8H3 |
| InChIKey | XFWSJJZKHIINGP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|