C14H21BClNO3 — CID 162688204
2-[6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-2-ol (PubChem CID 162688204) has the molecular formula C14H21BClNO3 and a molecular weight of 297.59 g/mol. Its IUPAC name is 2-[6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 162688204 |
| Molecular Formula | C14H21BClNO3 |
| Molecular Weight | 297.59 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(Cl)n1 |
| InChI | InChI=1S/C14H21BClNO3/c1-12(2,18)10-7-9(8-11(16)17-10)15-19-13(3,4)14(5,6)20-15/h7-8,18H,1-6H3 |
| InChIKey | ZIJNIWKUEVSPEZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|