C11H14BClNO2Y- — CID 169024640
6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-2-ide;yttrium (PubChem CID 169024640) has the molecular formula C11H14BClNO2Y- and a molecular weight of 327.41 g/mol. Its IUPAC name is 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-2-ide;yttrium.
| Compound Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 169024640 |
| Molecular Formula | C11H14BClNO2Y- |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyridin-2-ide;yttrium |
| SMILES | CC1(C)OB(c2c[c-]nc(Cl)c2)OC1(C)C.[Y] |
| InChI | InChI=1S/C11H14BClNO2.Y/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8;/h5,7H,1-4H3;/q-1; |
| InChIKey | QYYSDGPBSXLBGL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|