C9H13BClNO3 — CID 57416415
3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (PubChem CID 57416415) has the molecular formula C9H13BClNO3 and a molecular weight of 229.47 g/mol. Its IUPAC name is 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole.
| Compound Name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 57416415 |
| Molecular Formula | C9H13BClNO3 |
| Molecular Weight | 229.47 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| SMILES | CC1(C)OB(c2cc(Cl)no2)OC1(C)C |
| InChI | InChI=1S/C9H13BClNO3/c1-8(2)9(3,4)15-10(14-8)6-5-7(11)12-13-6/h5H,1-4H3 |
| InChIKey | ZBJYIXZANFXRTJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|