About 3-chloro-5-methyl-1,2-oxazole;ethane
3-chloro-5-methyl-1,2-oxazole;ethane (PubChem CID 168950747) has the molecular formula C6H10ClNO
and a molecular weight of 147.60 g/mol. Its IUPAC name is 3-chloro-5-methyl-1,2-oxazole;ethane.
Molecular Properties
| Compound Name | 3-chloro-5-methyl-1,2-oxazole;ethane |
| PubChem CID | 168950747 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 3-chloro-5-methyl-1,2-oxazole;ethane |
| SMILES | CC.Cc1cc(Cl)no1 |
| InChI | InChI=1S/C4H4ClNO.C2H6/c1-3-2-4(5)6-7-3;1-2/h2H,1H3;1-2H3 |
| InChIKey | LRXYUABNOOTFCJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-5-methyl-1,2-oxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methyl-1,2-oxazole;ethane?
The IUPAC name of 3-chloro-5-methyl-1,2-oxazole;ethane (CID 168950747) is 3-chloro-5-methyl-1,2-oxazole;ethane.
What is the SMILES notation for 3-chloro-5-methyl-1,2-oxazole;ethane?
The canonical SMILES for 3-chloro-5-methyl-1,2-oxazole;ethane is CC.Cc1cc(Cl)no1.
What is the InChIKey of 3-chloro-5-methyl-1,2-oxazole;ethane?
The InChIKey is LRXYUABNOOTFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNO.C2H6/c1-3-2-4(5)6-7-3;1-2/h2H,1H3;1-2H3.
What are the key properties of 3-chloro-5-methyl-1,2-oxazole;ethane?
3-chloro-5-methyl-1,2-oxazole;ethane has a molecular weight of 147.60 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methyl-1,2-oxazole;ethane is sourced from PubChem (CID 168950747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).