C6H11NO — CID 162114046
3,5-dimethyl-1,2-oxazole;methane (PubChem CID 162114046) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-oxazole;methane.
| Compound Name | 3,5-dimethyl-1,2-oxazole;methane |
|---|---|
| PubChem CID | 162114046 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 3,5-dimethyl-1,2-oxazole;methane |
| SMILES | C.Cc1cc(C)on1 |
| InChI | InChI=1S/C5H7NO.CH4/c1-4-3-5(2)7-6-4;/h3H,1-2H3;1H4 |
| InChIKey | ZGNKTVUOWNDODC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |