C4H6N2O — CID 44887048
N,N-dideuterio-3-methyl-1,2-oxazol-5-amine (PubChem CID 44887048) has the molecular formula C4H6N2O and a molecular weight of 100.12 g/mol. Its IUPAC name is N,N-dideuterio-3-methyl-1,2-oxazol-5-amine.
| Compound Name | N,N-dideuterio-3-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 44887048 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | N,N-dideuterio-3-methyl-1,2-oxazol-5-amine |
| SMILES | [2H]N([2H])c1cc(C)no1 |
| InChI | InChI=1S/C4H6N2O/c1-3-2-4(5)7-6-3/h2H,5H2,1H3/i/hD2 |
| InChIKey | FNXYWHTZDAVRTB-ZSJDYOACSA-N |
| XLogP | 0.57 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |