C9H9NO2 — CID 116868998
3-methyl-5-(5-methylfuran-2-yl)-1,2-oxazole (PubChem CID 116868998) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-methyl-5-(5-methylfuran-2-yl)-1,2-oxazole.
| Compound Name | 3-methyl-5-(5-methylfuran-2-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 116868998 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-methyl-5-(5-methylfuran-2-yl)-1,2-oxazole |
| SMILES | Cc1cc(-c2ccc(C)o2)on1 |
| InChI | InChI=1S/C9H9NO2/c1-6-5-9(12-10-6)8-4-3-7(2)11-8/h3-5H,1-2H3 |
| InChIKey | YTGZCWFKHILKPH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |