C6H10ClN3O2 — CID 66651040
2-(3-methyl-1,2-oxazol-5-yl)acetohydrazide;hydrochloride (PubChem CID 66651040) has the molecular formula C6H10ClN3O2 and a molecular weight of 191.62 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)acetohydrazide;hydrochloride.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)acetohydrazide;hydrochloride |
|---|---|
| PubChem CID | 66651040 |
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)acetohydrazide;hydrochloride |
| SMILES | Cc1cc(CC(=O)NN)on1.Cl |
| InChI | InChI=1S/C6H9N3O2.ClH/c1-4-2-5(11-9-4)3-6(10)8-7;/h2H,3,7H2,1H3,(H,8,10);1H |
| InChIKey | QIMWBSATGZOIDL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|