C9H10N4O2S — CID 164879655
2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide (PubChem CID 164879655) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide.
| Compound Name | 2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 164879655 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(3-methyl-1,2-oxazol-5-yl)-N-(5-sulfanylidene-1,2-dihydropyrazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)Nc2cc(=S)[nH][nH]2)on1 |
| InChI | InChI=1S/C9H10N4O2S/c1-5-2-6(15-13-5)3-8(14)10-7-4-9(16)12-11-7/h2,4H,3H2,1H3,(H3,10,11,12,14,16) |
| InChIKey | DEXGASHOAJLOPI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|