C4H4KNO2 — CID 23697409
potassium 5-methyl-1,2-oxazol-3-olate (PubChem CID 23697409) has the molecular formula C4H4KNO2 and a molecular weight of 137.18 g/mol. Its IUPAC name is potassium 5-methyl-1,2-oxazol-3-olate.
| Compound Name | potassium 5-methyl-1,2-oxazol-3-olate |
|---|---|
| PubChem CID | 23697409 |
| Molecular Formula | C4H4KNO2 |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 136.99 |
| IUPAC Name | potassium 5-methyl-1,2-oxazol-3-olate |
| SMILES | Cc1cc([O-])no1.[K+] |
| InChI | InChI=1S/C4H5NO2.K/c1-3-2-4(6)5-7-3;/h2H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | MLKWHMVAJLAVRH-UHFFFAOYSA-M |
| XLogP | -2.94 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |