C7H10N2O3 — CID 45099367
N-methoxy-N,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 45099367) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is N-methoxy-N,5-dimethyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-methoxy-N,5-dimethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 45099367 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | N-methoxy-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | CON(C)C(=O)c1cc(C)on1 |
| InChI | InChI=1S/C7H10N2O3/c1-5-4-6(8-12-5)7(10)9(2)11-3/h4H,1-3H3 |
| InChIKey | HTBHHCWUGFRTMB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|