C8H11ClN2O2 — CID 66156018
N-(2-chloroethyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 66156018) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloroethyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 66156018 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(2-chloroethyl)-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CCCl)no1 |
| InChI | InChI=1S/C8H11ClN2O2/c1-6-5-7(10-13-6)8(12)11(2)4-3-9/h5H,3-4H2,1-2H3 |
| InChIKey | VSPVHCQFQJLMKT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|