C9H13BrN2O2 — CID 80660169
N-(2-bromoethyl)-N-ethyl-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 80660169) has the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-ethyl-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-ethyl-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 80660169 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | N-(2-bromoethyl)-N-ethyl-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CCBr)C(=O)c1cc(C)on1 |
| InChI | InChI=1S/C9H13BrN2O2/c1-3-12(5-4-10)9(13)8-6-7(2)14-11-8/h6H,3-5H2,1-2H3 |
| InChIKey | HAWGTIXEXHKGSJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|