C14H15BrN2O2 — CID 80661970
N-benzyl-N-(2-bromoethyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 80661970) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-benzyl-N-(2-bromoethyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 80661970 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCBr)Cc2ccccc2)no1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-11-9-13(16-19-11)14(18)17(8-7-15)10-12-5-3-2-4-6-12/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | OQCQONWHZHEXMM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|