C16H16BrNO3 — CID 107705893
N-benzyl-N-(2-bromoethyl)-3,5-dihydroxybenzamide (PubChem CID 107705893) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)-3,5-dihydroxybenzamide.
| Compound Name | N-benzyl-N-(2-bromoethyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107705893 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(c1cc(O)cc(O)c1)N(CCBr)Cc1ccccc1 |
| InChI | InChI=1S/C16H16BrNO3/c17-6-7-18(11-12-4-2-1-3-5-12)16(21)13-8-14(19)10-15(20)9-13/h1-5,8-10,19-20H,6-7,11H2 |
| InChIKey | DHIBAYKUAMOMEZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|