C16H14BrF2NO — CID 80655955
N-benzyl-N-(2-bromoethyl)-2,5-difluorobenzamide (PubChem CID 80655955) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)-2,5-difluorobenzamide.
| Compound Name | N-benzyl-N-(2-bromoethyl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 80655955 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)-2,5-difluorobenzamide |
| SMILES | O=C(c1cc(F)ccc1F)N(CCBr)Cc1ccccc1 |
| InChI | InChI=1S/C16H14BrF2NO/c17-8-9-20(11-12-4-2-1-3-5-12)16(21)14-10-13(18)6-7-15(14)19/h1-7,10H,8-9,11H2 |
| InChIKey | OIYAPJQENHBDDP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|