C10H19NO2 — CID 144886330
ethane;1-(5-methyl-1,2-oxazol-3-yl)ethanone (PubChem CID 144886330) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is ethane;1-(5-methyl-1,2-oxazol-3-yl)ethanone.
| Compound Name | ethane;1-(5-methyl-1,2-oxazol-3-yl)ethanone |
|---|---|
| PubChem CID | 144886330 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | ethane;1-(5-methyl-1,2-oxazol-3-yl)ethanone |
| SMILES | CC.CC.CC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C6H7NO2.2C2H6/c1-4-3-6(5(2)8)7-9-4;2*1-2/h3H,1-2H3;2*1-2H3 |
| InChIKey | BWTMTJMJBTUDJY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |