C6H5N3O2 — CID 79193768
N-cyano-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 79193768) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is N-cyano-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyano-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 79193768 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | N-cyano-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC#N)no1 |
| InChI | InChI=1S/C6H5N3O2/c1-4-2-5(9-11-4)6(10)8-3-7/h2H,1H3,(H,8,10) |
| InChIKey | PELFHMDKLRZXMA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|