About N-cyano-5-methyl-1,2-oxazole-3-carboxamide
N-cyano-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 79193768) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is N-cyano-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyano-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 79193768 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | N-cyano-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC#N)no1 |
| InChI | InChI=1S/C6H5N3O2/c1-4-2-5(9-11-4)6(10)8-3-7/h2H,1H3,(H,8,10) |
| InChIKey | PELFHMDKLRZXMA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-cyano-5-methyl-1,2-oxazole-3-carboxamide (CID 79193768) is N-cyano-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-cyano-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-cyano-5-methyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)NC#N)no1.
What is the InChIKey of N-cyano-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is PELFHMDKLRZXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c1-4-2-5(9-11-4)6(10)8-3-7/h2H,1H3,(H,8,10).
What are the key properties of N-cyano-5-methyl-1,2-oxazole-3-carboxamide?
N-cyano-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 151.12 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 79193768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).