C10H12ClNO — CID 89381400
3-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]-5-methyl-1,2-oxazole (PubChem CID 89381400) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 3-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 89381400 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-[(2E,4E)-5-chlorohexa-2,4-dien-2-yl]-5-methyl-1,2-oxazole |
| SMILES | C/C(Cl)=C\C=C(/C)c1cc(C)on1 |
| InChI | InChI=1S/C10H12ClNO/c1-7(4-5-8(2)11)10-6-9(3)13-12-10/h4-6H,1-3H3/b7-4+,8-5+ |
| InChIKey | UEZHIASJIRMEDM-NSLJXJERSA-N |
| XLogP | 3.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|