C8H9NO2 — CID 83681907
cyclopropyl-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 83681907) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is cyclopropyl-(5-methyl-1,2-oxazol-3-yl)methanone.
| Compound Name | cyclopropyl-(5-methyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 83681907 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | cyclopropyl-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)C2CC2)no1 |
| InChI | InChI=1S/C8H9NO2/c1-5-4-7(9-11-5)8(10)6-2-3-6/h4,6H,2-3H2,1H3 |
| InChIKey | SNYHUKBZBOLMDC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |