C12H13NO2 — CID 131865881
[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 131865881) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-(5-methyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-(5-methyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 131865881 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)[C@@H]2C[C@H]3C=C[C@@H]2C3)no1 |
| InChI | InChI=1S/C12H13NO2/c1-7-4-11(13-15-7)12(14)10-6-8-2-3-9(10)5-8/h2-4,8-10H,5-6H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | GMSCXMBAFDVBFP-IVZWLZJFSA-N |
| XLogP | 2.38 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|