C8H9AgO2 — CID 121435616
silver bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 121435616) has the molecular formula C8H9AgO2 and a molecular weight of 245.03 g/mol. Its IUPAC name is silver bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | silver bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 121435616 |
| Molecular Formula | C8H9AgO2 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | silver bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])C1CC2C=CC1C2.[Ag+] |
| InChI | InChI=1S/C8H10O2.Ag/c9-8(10)7-4-5-1-2-6(7)3-5;/h1-2,5-7H,3-4H2,(H,9,10);/q;+1/p-1 |
| InChIKey | IYUVDWZVMZBSAW-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|