C8H10O2Zr — CID 87662542
bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;zirconium (PubChem CID 87662542) has the molecular formula C8H10O2Zr and a molecular weight of 229.39 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;zirconium.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;zirconium |
|---|---|
| PubChem CID | 87662542 |
| Molecular Formula | C8H10O2Zr |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;zirconium |
| SMILES | O=C(O)C1CC2C=CC1C2.[Zr] |
| InChI | InChI=1S/C8H10O2.Zr/c9-8(10)7-4-5-1-2-6(7)3-5;/h1-2,5-7H,3-4H2,(H,9,10); |
| InChIKey | JIAZYVOCEQETAC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|