C16H23NO2 — CID 44889483
bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methanamine (PubChem CID 44889483) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methanamine.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methanamine |
|---|---|
| PubChem CID | 44889483 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methanamine |
| SMILES | NC[C@H]1CC2C=CC1C2.O=C(O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C8H13N.C8H10O2/c9-5-8-4-6-1-2-7(8)3-6;9-8(10)7-4-5-1-2-6(7)3-5/h1-2,6-8H,3-5,9H2;1-2,5-7H,3-4H2,(H,9,10)/t6?,7?,8-;/m1./s1 |
| InChIKey | WAZUPUFQFADRQB-XJRLSETOSA-N |
| XLogP | 2.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|