C9H12O2 — CID 102120201
2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid (PubChem CID 102120201) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid.
| Compound Name | 2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
|---|---|
| PubChem CID | 102120201 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-[(1S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
| SMILES | O=C(O)CC1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H12O2/c10-9(11)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,10,11)/t6-,7+,8?/m1/s1 |
| InChIKey | HRVGJQMCNYJEHM-KVARREAHSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|